C16H22FNO2 — CID 124752994
(2-fluoro-3-methylphenyl)-[(3R)-3-(2-methoxyethyl)piperidin-1-yl]methanone (PubChem CID 124752994) has the molecular formula C16H22FNO2 and a molecular weight of 279.35 g/mol. Its IUPAC name is (2-fluoro-3-methylphenyl)-[(3R)-3-(2-methoxyethyl)piperidin-1-yl]methanone.
| Compound Name | (2-fluoro-3-methylphenyl)-[(3R)-3-(2-methoxyethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 124752994 |
| Molecular Formula | C16H22FNO2 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (2-fluoro-3-methylphenyl)-[(3R)-3-(2-methoxyethyl)piperidin-1-yl]methanone |
| SMILES | COCC[C@H]1CCCN(C(=O)c2cccc(C)c2F)C1 |
| InChI | InChI=1S/C16H22FNO2/c1-12-5-3-7-14(15(12)17)16(19)18-9-4-6-13(11-18)8-10-20-2/h3,5,7,13H,4,6,8-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | KWHHJKXKYBWOAZ-CYBMUJFWSA-N |
| XLogP | 3.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |