C22H26FNO2 — CID 70713781
[2-(4-fluorophenyl)phenyl]-[3-(3-methoxypropyl)piperidin-1-yl]methanone (PubChem CID 70713781) has the molecular formula C22H26FNO2 and a molecular weight of 355.45 g/mol. Its IUPAC name is [2-(4-fluorophenyl)phenyl]-[3-(3-methoxypropyl)piperidin-1-yl]methanone.
| Compound Name | [2-(4-fluorophenyl)phenyl]-[3-(3-methoxypropyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 70713781 |
| Molecular Formula | C22H26FNO2 |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | [2-(4-fluorophenyl)phenyl]-[3-(3-methoxypropyl)piperidin-1-yl]methanone |
| SMILES | COCCCC1CCCN(C(=O)c2ccccc2-c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C22H26FNO2/c1-26-15-5-7-17-6-4-14-24(16-17)22(25)21-9-3-2-8-20(21)18-10-12-19(23)13-11-18/h2-3,8-13,17H,4-7,14-16H2,1H3 |
| InChIKey | OIMDIVDAQBUDPU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|