C21H27N3O3 — CID 97137870
5-[(3R)-3-(3-methoxypropyl)piperidine-1-carbonyl]-2-(4-methylphenyl)-1H-pyrimidin-6-one (PubChem CID 97137870) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is 5-[(3R)-3-(3-methoxypropyl)piperidine-1-carbonyl]-2-(4-methylphenyl)-1H-pyrimidin-6-one.
| Compound Name | 5-[(3R)-3-(3-methoxypropyl)piperidine-1-carbonyl]-2-(4-methylphenyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 97137870 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 5-[(3R)-3-(3-methoxypropyl)piperidine-1-carbonyl]-2-(4-methylphenyl)-1H-pyrimidin-6-one |
| SMILES | COCCC[C@H]1CCCN(C(=O)c2cnc(-c3ccc(C)cc3)[nH]c2=O)C1 |
| InChI | InChI=1S/C21H27N3O3/c1-15-7-9-17(10-8-15)19-22-13-18(20(25)23-19)21(26)24-11-3-5-16(14-24)6-4-12-27-2/h7-10,13,16H,3-6,11-12,14H2,1-2H3,(H,22,23,25)/t16-/m1/s1 |
| InChIKey | OLFWCAVMAOGFDX-MRXNPFEDSA-N |
| XLogP | 3.02 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|