C20H25ClN2O2 — CID 97138571
(6-chloro-2-methylquinolin-4-yl)-[(3R)-3-(3-methoxypropyl)piperidin-1-yl]methanone (PubChem CID 97138571) has the molecular formula C20H25ClN2O2 and a molecular weight of 360.89 g/mol. Its IUPAC name is (6-chloro-2-methylquinolin-4-yl)-[(3R)-3-(3-methoxypropyl)piperidin-1-yl]methanone.
| Compound Name | (6-chloro-2-methylquinolin-4-yl)-[(3R)-3-(3-methoxypropyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 97138571 |
| Molecular Formula | C20H25ClN2O2 |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (6-chloro-2-methylquinolin-4-yl)-[(3R)-3-(3-methoxypropyl)piperidin-1-yl]methanone |
| SMILES | COCCC[C@H]1CCCN(C(=O)c2cc(C)nc3ccc(Cl)cc23)C1 |
| InChI | InChI=1S/C20H25ClN2O2/c1-14-11-18(17-12-16(21)7-8-19(17)22-14)20(24)23-9-3-5-15(13-23)6-4-10-25-2/h7-8,11-12,15H,3-6,9-10,13H2,1-2H3/t15-/m1/s1 |
| InChIKey | CBPRYPXEBPGIEF-OAHLLOKOSA-N |
| XLogP | 4.48 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|