C19H24ClN3O2 — CID 97134012
(2-chloro-5-pyrazol-1-ylphenyl)-[(3S)-3-(3-methoxypropyl)piperidin-1-yl]methanone (PubChem CID 97134012) has the molecular formula C19H24ClN3O2 and a molecular weight of 361.87 g/mol. Its IUPAC name is (2-chloro-5-pyrazol-1-ylphenyl)-[(3S)-3-(3-methoxypropyl)piperidin-1-yl]methanone.
| Compound Name | (2-chloro-5-pyrazol-1-ylphenyl)-[(3S)-3-(3-methoxypropyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 97134012 |
| Molecular Formula | C19H24ClN3O2 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | (2-chloro-5-pyrazol-1-ylphenyl)-[(3S)-3-(3-methoxypropyl)piperidin-1-yl]methanone |
| SMILES | COCCC[C@@H]1CCCN(C(=O)c2cc(-n3cccn3)ccc2Cl)C1 |
| InChI | InChI=1S/C19H24ClN3O2/c1-25-12-3-6-15-5-2-10-22(14-15)19(24)17-13-16(7-8-18(17)20)23-11-4-9-21-23/h4,7-9,11,13,15H,2-3,5-6,10,12,14H2,1H3/t15-/m0/s1 |
| InChIKey | VNFADMLFVSLPGG-HNNXBMFYSA-N |
| XLogP | 3.80 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|