C17H24FNO2 — CID 96572024
(5-fluoro-2-methylphenyl)-[(3S)-3-(3-methoxypropyl)piperidin-1-yl]methanone (PubChem CID 96572024) has the molecular formula C17H24FNO2 and a molecular weight of 293.38 g/mol. Its IUPAC name is (5-fluoro-2-methylphenyl)-[(3S)-3-(3-methoxypropyl)piperidin-1-yl]methanone.
| Compound Name | (5-fluoro-2-methylphenyl)-[(3S)-3-(3-methoxypropyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 96572024 |
| Molecular Formula | C17H24FNO2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (5-fluoro-2-methylphenyl)-[(3S)-3-(3-methoxypropyl)piperidin-1-yl]methanone |
| SMILES | COCCC[C@@H]1CCCN(C(=O)c2cc(F)ccc2C)C1 |
| InChI | InChI=1S/C17H24FNO2/c1-13-7-8-15(18)11-16(13)17(20)19-9-3-5-14(12-19)6-4-10-21-2/h7-8,11,14H,3-6,9-10,12H2,1-2H3/t14-/m0/s1 |
| InChIKey | HYVDSAZSEDUGLH-AWEZNQCLSA-N |
| XLogP | 3.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|