C18H25F2NO2 — CID 97136529
3-(2,4-difluorophenyl)-1-[(3S)-3-(3-methoxypropyl)piperidin-1-yl]propan-1-one (PubChem CID 97136529) has the molecular formula C18H25F2NO2 and a molecular weight of 325.40 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-1-[(3S)-3-(3-methoxypropyl)piperidin-1-yl]propan-1-one.
| Compound Name | 3-(2,4-difluorophenyl)-1-[(3S)-3-(3-methoxypropyl)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 97136529 |
| Molecular Formula | C18H25F2NO2 |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 3-(2,4-difluorophenyl)-1-[(3S)-3-(3-methoxypropyl)piperidin-1-yl]propan-1-one |
| SMILES | COCCC[C@@H]1CCCN(C(=O)CCc2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C18H25F2NO2/c1-23-11-3-5-14-4-2-10-21(13-14)18(22)9-7-15-6-8-16(19)12-17(15)20/h6,8,12,14H,2-5,7,9-11,13H2,1H3/t14-/m0/s1 |
| InChIKey | BZFUPSADLAEYQH-AWEZNQCLSA-N |
| XLogP | 3.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|