C18H22BrN3O — CID 124684515
(6-bromo-2-methylquinolin-4-yl)-[(3R)-3-(methylaminomethyl)piperidin-1-yl]methanone (PubChem CID 124684515) has the molecular formula C18H22BrN3O and a molecular weight of 376.30 g/mol. Its IUPAC name is (6-bromo-2-methylquinolin-4-yl)-[(3R)-3-(methylaminomethyl)piperidin-1-yl]methanone.
| Compound Name | (6-bromo-2-methylquinolin-4-yl)-[(3R)-3-(methylaminomethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 124684515 |
| Molecular Formula | C18H22BrN3O |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | (6-bromo-2-methylquinolin-4-yl)-[(3R)-3-(methylaminomethyl)piperidin-1-yl]methanone |
| SMILES | CNC[C@H]1CCCN(C(=O)c2cc(C)nc3ccc(Br)cc23)C1 |
| InChI | InChI=1S/C18H22BrN3O/c1-12-8-16(15-9-14(19)5-6-17(15)21-12)18(23)22-7-3-4-13(11-22)10-20-2/h5-6,8-9,13,20H,3-4,7,10-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | DTGMZLPKZLOASX-CYBMUJFWSA-N |
| XLogP | 3.38 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |