C17H20BrN3O — CID 119560432
(6-bromo-2-methylquinolin-4-yl)-[4-(methylamino)piperidin-1-yl]methanone (PubChem CID 119560432) has the molecular formula C17H20BrN3O and a molecular weight of 362.27 g/mol. Its IUPAC name is (6-bromo-2-methylquinolin-4-yl)-[4-(methylamino)piperidin-1-yl]methanone.
| Compound Name | (6-bromo-2-methylquinolin-4-yl)-[4-(methylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 119560432 |
| Molecular Formula | C17H20BrN3O |
| Molecular Weight | 362.27 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | (6-bromo-2-methylquinolin-4-yl)-[4-(methylamino)piperidin-1-yl]methanone |
| SMILES | CNC1CCN(C(=O)c2cc(C)nc3ccc(Br)cc23)CC1 |
| InChI | InChI=1S/C17H20BrN3O/c1-11-9-15(14-10-12(18)3-4-16(14)20-11)17(22)21-7-5-13(19-2)6-8-21/h3-4,9-10,13,19H,5-8H2,1-2H3 |
| InChIKey | MNAGBVLJCOMEBI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |