C16H18BrN3O — CID 124593306
[(3R)-3-aminopiperidin-1-yl]-(6-bromo-2-methylquinolin-4-yl)methanone (PubChem CID 124593306) has the molecular formula C16H18BrN3O and a molecular weight of 348.24 g/mol. Its IUPAC name is [(3R)-3-aminopiperidin-1-yl]-(6-bromo-2-methylquinolin-4-yl)methanone.
| Compound Name | [(3R)-3-aminopiperidin-1-yl]-(6-bromo-2-methylquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 124593306 |
| Molecular Formula | C16H18BrN3O |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | [(3R)-3-aminopiperidin-1-yl]-(6-bromo-2-methylquinolin-4-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCC[C@@H](N)C2)c2cc(Br)ccc2n1 |
| InChI | InChI=1S/C16H18BrN3O/c1-10-7-14(13-8-11(17)4-5-15(13)19-10)16(21)20-6-2-3-12(18)9-20/h4-5,7-8,12H,2-3,6,9,18H2,1H3/t12-/m1/s1 |
| InChIKey | LIGHPAFWQJGQIB-GFCCVEGCSA-N |
| XLogP | 2.87 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |