C18H22Cl2FN3O — CID 119378902
(3-aminopiperidin-1-yl)-(2-cyclopropyl-6-fluoroquinolin-4-yl)methanone;dihydrochloride (PubChem CID 119378902) has the molecular formula C18H22Cl2FN3O and a molecular weight of 386.30 g/mol. Its IUPAC name is (3-aminopiperidin-1-yl)-(2-cyclopropyl-6-fluoroquinolin-4-yl)methanone;dihydrochloride.
| Compound Name | (3-aminopiperidin-1-yl)-(2-cyclopropyl-6-fluoroquinolin-4-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119378902 |
| Molecular Formula | C18H22Cl2FN3O |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | (3-aminopiperidin-1-yl)-(2-cyclopropyl-6-fluoroquinolin-4-yl)methanone;dihydrochloride |
| SMILES | Cl.Cl.NC1CCCN(C(=O)c2cc(C3CC3)nc3ccc(F)cc23)C1 |
| InChI | InChI=1S/C18H20FN3O.2ClH/c19-12-5-6-16-14(8-12)15(9-17(21-16)11-3-4-11)18(23)22-7-1-2-13(20)10-22;;/h5-6,8-9,11,13H,1-4,7,10,20H2;2*1H |
| InChIKey | ZOBXWHBAUAHRAE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |