C21H25N3O3 — CID 70724691
5-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carbonyl]-2-(4-methylphenyl)-1H-pyrimidin-6-one (PubChem CID 70724691) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 5-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carbonyl]-2-(4-methylphenyl)-1H-pyrimidin-6-one.
| Compound Name | 5-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carbonyl]-2-(4-methylphenyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 70724691 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 5-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carbonyl]-2-(4-methylphenyl)-1H-pyrimidin-6-one |
| SMILES | Cc1ccc(-c2ncc(C(=O)N3CC[C@@]4(O)CCCC[C@H]4C3)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C21H25N3O3/c1-14-5-7-15(8-6-14)18-22-12-17(19(25)23-18)20(26)24-11-10-21(27)9-3-2-4-16(21)13-24/h5-8,12,16,27H,2-4,9-11,13H2,1H3,(H,22,23,25)/t16-,21-/m0/s1 |
| InChIKey | ZDNODYYPRMBKEW-KKSFZXQISA-N |
| XLogP | 2.51 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |