C6F4INO2 — CID 23234800
1,2,4,5-tetrafluoro-3-iodo-6-nitrobenzene (PubChem CID 23234800) has the molecular formula C6F4INO2 and a molecular weight of 320.97 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-iodo-6-nitrobenzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-iodo-6-nitrobenzene |
|---|---|
| PubChem CID | 23234800 |
| Molecular Formula | C6F4INO2 |
| Molecular Weight | 320.97 g/mol |
| Exact Mass | 320.89 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-iodo-6-nitrobenzene |
| SMILES | O=[N+]([O-])c1c(F)c(F)c(I)c(F)c1F |
| InChI | InChI=1S/C6F4INO2/c7-1-3(9)6(12(13)14)4(10)2(8)5(1)11 |
| InChIKey | BUMDVPWAFSIHFX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.97 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|