About 1,3-difluoro-5-iodo-2,4-dinitrobenzene
1,3-difluoro-5-iodo-2,4-dinitrobenzene (PubChem CID 87535078) has the molecular formula C6HF2IN2O4
and a molecular weight of 329.98 g/mol. Its IUPAC name is 1,3-difluoro-5-iodo-2,4-dinitrobenzene.
Molecular Properties
| Compound Name | 1,3-difluoro-5-iodo-2,4-dinitrobenzene |
| PubChem CID | 87535078 |
| Molecular Formula | C6HF2IN2O4 |
| Molecular Weight | 329.98 g/mol |
| Exact Mass | 329.89 |
| IUPAC Name | 1,3-difluoro-5-iodo-2,4-dinitrobenzene |
| SMILES | O=[N+]([O-])c1c(F)cc(I)c([N+](=O)[O-])c1F |
| InChI | InChI=1S/C6HF2IN2O4/c7-2-1-3(9)6(11(14)15)4(8)5(2)10(12)13/h1H |
| InChIKey | CLPHAVOJVKONNP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.98 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,3-difluoro-5-iodo-2,4-dinitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-difluoro-5-iodo-2,4-dinitrobenzene?
The IUPAC name of 1,3-difluoro-5-iodo-2,4-dinitrobenzene (CID 87535078) is 1,3-difluoro-5-iodo-2,4-dinitrobenzene.
What is the SMILES notation for 1,3-difluoro-5-iodo-2,4-dinitrobenzene?
The canonical SMILES for 1,3-difluoro-5-iodo-2,4-dinitrobenzene is O=[N+]([O-])c1c(F)cc(I)c([N+](=O)[O-])c1F.
What is the InChIKey of 1,3-difluoro-5-iodo-2,4-dinitrobenzene?
The InChIKey is CLPHAVOJVKONNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6HF2IN2O4/c7-2-1-3(9)6(11(14)15)4(8)5(2)10(12)13/h1H.
What are the key properties of 1,3-difluoro-5-iodo-2,4-dinitrobenzene?
1,3-difluoro-5-iodo-2,4-dinitrobenzene has a molecular weight of 329.98 g/mol, XLogP of 2.39, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-difluoro-5-iodo-2,4-dinitrobenzene is sourced from PubChem (CID 87535078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).