C6HCl2F2NO2 — CID 10911296
2,4-dichloro-1,5-difluoro-3-nitrobenzene (PubChem CID 10911296) has the molecular formula C6HCl2F2NO2 and a molecular weight of 227.98 g/mol. Its IUPAC name is 2,4-dichloro-1,5-difluoro-3-nitrobenzene.
| Compound Name | 2,4-dichloro-1,5-difluoro-3-nitrobenzene |
|---|---|
| PubChem CID | 10911296 |
| Molecular Formula | C6HCl2F2NO2 |
| Molecular Weight | 227.98 g/mol |
| Exact Mass | 226.94 |
| IUPAC Name | 2,4-dichloro-1,5-difluoro-3-nitrobenzene |
| SMILES | O=[N+]([O-])c1c(Cl)c(F)cc(F)c1Cl |
| InChI | InChI=1S/C6HCl2F2NO2/c7-4-2(9)1-3(10)5(8)6(4)11(12)13/h1H |
| InChIKey | VGDZGWPMCGMBEO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.98 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|