C7H5ClF2N2O2 — CID 122497392
4-chloro-3,5-difluoro-N-methyl-2-nitroaniline (PubChem CID 122497392) has the molecular formula C7H5ClF2N2O2 and a molecular weight of 222.58 g/mol. Its IUPAC name is 4-chloro-3,5-difluoro-N-methyl-2-nitroaniline.
| Compound Name | 4-chloro-3,5-difluoro-N-methyl-2-nitroaniline |
|---|---|
| PubChem CID | 122497392 |
| Molecular Formula | C7H5ClF2N2O2 |
| Molecular Weight | 222.58 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | 4-chloro-3,5-difluoro-N-methyl-2-nitroaniline |
| SMILES | CNc1cc(F)c(Cl)c(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H5ClF2N2O2/c1-11-4-2-3(9)5(8)6(10)7(4)12(13)14/h2,11H,1H3 |
| InChIKey | JBOCJUJDGDBPNU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.58 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|