C8H9FN2O2 — CID 131053180
4-fluoro-N,2-dimethyl-3-nitroaniline (PubChem CID 131053180) has the molecular formula C8H9FN2O2 and a molecular weight of 184.17 g/mol. Its IUPAC name is 4-fluoro-N,2-dimethyl-3-nitroaniline.
| Compound Name | 4-fluoro-N,2-dimethyl-3-nitroaniline |
|---|---|
| PubChem CID | 131053180 |
| Molecular Formula | C8H9FN2O2 |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 4-fluoro-N,2-dimethyl-3-nitroaniline |
| SMILES | CNc1ccc(F)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C8H9FN2O2/c1-5-7(10-2)4-3-6(9)8(5)11(12)13/h3-4,10H,1-2H3 |
| InChIKey | XQFXTGOWFKGJQJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|