C17H28F2N4O2 — CID 158262023
3-fluoro-1-N-methylbenzene-1,2-diamine;3-fluoro-N-methyl-2-nitroaniline;methane (PubChem CID 158262023) has the molecular formula C17H28F2N4O2 and a molecular weight of 358.43 g/mol. Its IUPAC name is 3-fluoro-1-N-methylbenzene-1,2-diamine;3-fluoro-N-methyl-2-nitroaniline;methane.
| Compound Name | 3-fluoro-1-N-methylbenzene-1,2-diamine;3-fluoro-N-methyl-2-nitroaniline;methane |
|---|---|
| PubChem CID | 158262023 |
| Molecular Formula | C17H28F2N4O2 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | 3-fluoro-1-N-methylbenzene-1,2-diamine;3-fluoro-N-methyl-2-nitroaniline;methane |
| SMILES | C.C.C.CNc1cccc(F)c1N.CNc1cccc(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H7FN2O2.C7H9FN2.3CH4/c1-9-6-4-2-3-5(8)7(6)10(11)12;1-10-6-4-2-3-5(8)7(6)9;;;/h2-4,9H,1H3;2-4,10H,9H2,1H3;3*1H4 |
| InChIKey | GHZGJEVBLPGXRN-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|