C6H4F2N2O2 — CID 87619715
N,3-difluoro-2-nitroaniline (PubChem CID 87619715) has the molecular formula C6H4F2N2O2 and a molecular weight of 174.11 g/mol. Its IUPAC name is N,3-difluoro-2-nitroaniline.
| Compound Name | N,3-difluoro-2-nitroaniline |
|---|---|
| PubChem CID | 87619715 |
| Molecular Formula | C6H4F2N2O2 |
| Molecular Weight | 174.11 g/mol |
| Exact Mass | 174.02 |
| IUPAC Name | N,3-difluoro-2-nitroaniline |
| SMILES | O=[N+]([O-])c1c(F)cccc1NF |
| InChI | InChI=1S/C6H4F2N2O2/c7-4-2-1-3-5(9-8)6(4)10(11)12/h1-3,9H |
| InChIKey | HXPJACDGXGQUKQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.11 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|