C8HCl3FN3O2 — CID 22097048
2,3,6-trichloro-7-fluoro-5-nitroquinoxaline (PubChem CID 22097048) has the molecular formula C8HCl3FN3O2 and a molecular weight of 296.47 g/mol. Its IUPAC name is 2,3,6-trichloro-7-fluoro-5-nitroquinoxaline.
| Compound Name | 2,3,6-trichloro-7-fluoro-5-nitroquinoxaline |
|---|---|
| PubChem CID | 22097048 |
| Molecular Formula | C8HCl3FN3O2 |
| Molecular Weight | 296.47 g/mol |
| Exact Mass | 294.91 |
| IUPAC Name | 2,3,6-trichloro-7-fluoro-5-nitroquinoxaline |
| SMILES | O=[N+]([O-])c1c(Cl)c(F)cc2nc(Cl)c(Cl)nc12 |
| InChI | InChI=1S/C8HCl3FN3O2/c9-4-2(12)1-3-5(6(4)15(16)17)14-8(11)7(10)13-3/h1H |
| InChIKey | PRYPNNYEDNRVTB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|