C10H5ClFN3O4 — CID 174367257
1-(7-chloro-6-fluoro-8-nitroquinoxalin-2-yl)ethene-1,2-diol (PubChem CID 174367257) has the molecular formula C10H5ClFN3O4 and a molecular weight of 285.62 g/mol. Its IUPAC name is 1-(7-chloro-6-fluoro-8-nitroquinoxalin-2-yl)ethene-1,2-diol.
| Compound Name | 1-(7-chloro-6-fluoro-8-nitroquinoxalin-2-yl)ethene-1,2-diol |
|---|---|
| PubChem CID | 174367257 |
| Molecular Formula | C10H5ClFN3O4 |
| Molecular Weight | 285.62 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | 1-(7-chloro-6-fluoro-8-nitroquinoxalin-2-yl)ethene-1,2-diol |
| SMILES | O=[N+]([O-])c1c(Cl)c(F)cc2ncc(C(O)=CO)nc12 |
| InChI | InChI=1S/C10H5ClFN3O4/c11-8-4(12)1-5-9(10(8)15(18)19)14-6(2-13-5)7(17)3-16/h1-3,16-17H |
| InChIKey | MJWFRMXXFDAKKV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 109.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.62 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|