C9H2Cl3FN2O2 — CID 107577340
4,5,7-trichloro-6-fluoro-3-nitroquinoline (PubChem CID 107577340) has the molecular formula C9H2Cl3FN2O2 and a molecular weight of 295.48 g/mol. Its IUPAC name is 4,5,7-trichloro-6-fluoro-3-nitroquinoline.
| Compound Name | 4,5,7-trichloro-6-fluoro-3-nitroquinoline |
|---|---|
| PubChem CID | 107577340 |
| Molecular Formula | C9H2Cl3FN2O2 |
| Molecular Weight | 295.48 g/mol |
| Exact Mass | 293.92 |
| IUPAC Name | 4,5,7-trichloro-6-fluoro-3-nitroquinoline |
| SMILES | O=[N+]([O-])c1cnc2cc(Cl)c(F)c(Cl)c2c1Cl |
| InChI | InChI=1S/C9H2Cl3FN2O2/c10-3-1-4-6(8(12)9(3)13)7(11)5(2-14-4)15(16)17/h1-2H |
| InChIKey | DXBZQCYFLJFBJY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|