C7H2ClF5N2O2 — CID 86811579
4-chloro-5-nitro-2-(1,1,2,2,2-pentafluoroethyl)pyridine (PubChem CID 86811579) has the molecular formula C7H2ClF5N2O2 and a molecular weight of 276.55 g/mol. Its IUPAC name is 4-chloro-5-nitro-2-(1,1,2,2,2-pentafluoroethyl)pyridine.
| Compound Name | 4-chloro-5-nitro-2-(1,1,2,2,2-pentafluoroethyl)pyridine |
|---|---|
| PubChem CID | 86811579 |
| Molecular Formula | C7H2ClF5N2O2 |
| Molecular Weight | 276.55 g/mol |
| Exact Mass | 275.97 |
| IUPAC Name | 4-chloro-5-nitro-2-(1,1,2,2,2-pentafluoroethyl)pyridine |
| SMILES | O=[N+]([O-])c1cnc(C(F)(F)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C7H2ClF5N2O2/c8-3-1-5(6(9,10)7(11,12)13)14-2-4(3)15(16)17/h1-2H |
| InChIKey | LFTFJADDBFHMQF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|