C8H2Cl2F5NO3 — CID 23052546
1,4-dichloro-2-nitro-5-(1,1,2,2,2-pentafluoroethoxy)benzene (PubChem CID 23052546) has the molecular formula C8H2Cl2F5NO3 and a molecular weight of 326.00 g/mol. Its IUPAC name is 1,4-dichloro-2-nitro-5-(1,1,2,2,2-pentafluoroethoxy)benzene.
| Compound Name | 1,4-dichloro-2-nitro-5-(1,1,2,2,2-pentafluoroethoxy)benzene |
|---|---|
| PubChem CID | 23052546 |
| Molecular Formula | C8H2Cl2F5NO3 |
| Molecular Weight | 326.00 g/mol |
| Exact Mass | 324.93 |
| IUPAC Name | 1,4-dichloro-2-nitro-5-(1,1,2,2,2-pentafluoroethoxy)benzene |
| SMILES | O=[N+]([O-])c1cc(Cl)c(OC(F)(F)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C8H2Cl2F5NO3/c9-3-2-6(4(10)1-5(3)16(17)18)19-8(14,15)7(11,12)13/h1-2H |
| InChIKey | ZAKDMEWICIMFDD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.00 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|