C13H7Cl4NO3 — CID 43350426
1,2,4-trichloro-5-[(4-chloro-3-nitrophenyl)methoxy]benzene (PubChem CID 43350426) has the molecular formula C13H7Cl4NO3 and a molecular weight of 367.02 g/mol. Its IUPAC name is 1,2,4-trichloro-5-[(4-chloro-3-nitrophenyl)methoxy]benzene.
| Compound Name | 1,2,4-trichloro-5-[(4-chloro-3-nitrophenyl)methoxy]benzene |
|---|---|
| PubChem CID | 43350426 |
| Molecular Formula | C13H7Cl4NO3 |
| Molecular Weight | 367.02 g/mol |
| Exact Mass | 364.92 |
| IUPAC Name | 1,2,4-trichloro-5-[(4-chloro-3-nitrophenyl)methoxy]benzene |
| SMILES | O=[N+]([O-])c1cc(COc2cc(Cl)c(Cl)cc2Cl)ccc1Cl |
| InChI | InChI=1S/C13H7Cl4NO3/c14-8-2-1-7(3-12(8)18(19)20)6-21-13-5-10(16)9(15)4-11(13)17/h1-5H,6H2 |
| InChIKey | NGAMIGZMMGRZSX-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.02 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|