C16H14ClNO3 — CID 43350469
5-[(4-chloro-3-nitrophenyl)methoxy]-2,3-dihydro-1H-indene (PubChem CID 43350469) has the molecular formula C16H14ClNO3 and a molecular weight of 303.75 g/mol. Its IUPAC name is 5-[(4-chloro-3-nitrophenyl)methoxy]-2,3-dihydro-1H-indene.
| Compound Name | 5-[(4-chloro-3-nitrophenyl)methoxy]-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 43350469 |
| Molecular Formula | C16H14ClNO3 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 5-[(4-chloro-3-nitrophenyl)methoxy]-2,3-dihydro-1H-indene |
| SMILES | O=[N+]([O-])c1cc(COc2ccc3c(c2)CCC3)ccc1Cl |
| InChI | InChI=1S/C16H14ClNO3/c17-15-7-4-11(8-16(15)18(19)20)10-21-14-6-5-12-2-1-3-13(12)9-14/h4-9H,1-3,10H2 |
| InChIKey | MWJFGVGFYSSJMT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|