C10H5ClN2O4 — CID 102613983
8-chloro-7-nitro-[1,3]dioxolo[4,5-g]quinoline (PubChem CID 102613983) has the molecular formula C10H5ClN2O4 and a molecular weight of 252.61 g/mol. Its IUPAC name is 8-chloro-7-nitro-[1,3]dioxolo[4,5-g]quinoline.
| Compound Name | 8-chloro-7-nitro-[1,3]dioxolo[4,5-g]quinoline |
|---|---|
| PubChem CID | 102613983 |
| Molecular Formula | C10H5ClN2O4 |
| Molecular Weight | 252.61 g/mol |
| Exact Mass | 251.99 |
| IUPAC Name | 8-chloro-7-nitro-[1,3]dioxolo[4,5-g]quinoline |
| SMILES | O=[N+]([O-])c1cnc2cc3c(cc2c1Cl)OCO3 |
| InChI | InChI=1S/C10H5ClN2O4/c11-10-5-1-8-9(17-4-16-8)2-6(5)12-3-7(10)13(14)15/h1-3H,4H2 |
| InChIKey | YDWVJASCSPGRMM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.61 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|