C8H6ClN3O2 — CID 126970309
4-chloro-3-methyl-5-nitro-1H-pyrrolo[2,3-b]pyridine (PubChem CID 126970309) has the molecular formula C8H6ClN3O2 and a molecular weight of 211.61 g/mol. Its IUPAC name is 4-chloro-3-methyl-5-nitro-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 4-chloro-3-methyl-5-nitro-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 126970309 |
| Molecular Formula | C8H6ClN3O2 |
| Molecular Weight | 211.61 g/mol |
| Exact Mass | 211.01 |
| IUPAC Name | 4-chloro-3-methyl-5-nitro-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Cc1c[nH]c2ncc([N+](=O)[O-])c(Cl)c12 |
| InChI | InChI=1S/C8H6ClN3O2/c1-4-2-10-8-6(4)7(9)5(3-11-8)12(13)14/h2-3H,1H3,(H,10,11) |
| InChIKey | DSFUDLWLGUPYPH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.61 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|