C7H4IN3O2 — CID 24729572
3-iodo-4-nitro-1H-pyrrolo[2,3-b]pyridine (PubChem CID 24729572) has the molecular formula C7H4IN3O2 and a molecular weight of 289.03 g/mol. Its IUPAC name is 3-iodo-4-nitro-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-iodo-4-nitro-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 24729572 |
| Molecular Formula | C7H4IN3O2 |
| Molecular Weight | 289.03 g/mol |
| Exact Mass | 288.93 |
| IUPAC Name | 3-iodo-4-nitro-1H-pyrrolo[2,3-b]pyridine |
| SMILES | O=[N+]([O-])c1ccnc2[nH]cc(I)c12 |
| InChI | InChI=1S/C7H4IN3O2/c8-4-3-10-7-6(4)5(11(12)13)1-2-9-7/h1-3H,(H,9,10) |
| InChIKey | XLVXZIOZDIALSM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.03 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|