C10H10IN3O3 — CID 146025571
3-iodo-1-(2-methoxyethyl)-4-nitropyrrolo[2,3-b]pyridine (PubChem CID 146025571) has the molecular formula C10H10IN3O3 and a molecular weight of 347.11 g/mol. Its IUPAC name is 3-iodo-1-(2-methoxyethyl)-4-nitropyrrolo[2,3-b]pyridine.
| Compound Name | 3-iodo-1-(2-methoxyethyl)-4-nitropyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 146025571 |
| Molecular Formula | C10H10IN3O3 |
| Molecular Weight | 347.11 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | 3-iodo-1-(2-methoxyethyl)-4-nitropyrrolo[2,3-b]pyridine |
| SMILES | COCCn1cc(I)c2c([N+](=O)[O-])ccnc21 |
| InChI | InChI=1S/C10H10IN3O3/c1-17-5-4-13-6-7(11)9-8(14(15)16)2-3-12-10(9)13/h2-3,6H,4-5H2,1H3 |
| InChIKey | DBVPTLQKQJQUBF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.11 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|