About 3-iodo-4-nitro-1H-pyrrolo[2,3-c]pyridine
3-iodo-4-nitro-1H-pyrrolo[2,3-c]pyridine (PubChem CID 53412698) has the molecular formula C7H4IN3O2
and a molecular weight of 289.03 g/mol. Its IUPAC name is 3-iodo-4-nitro-1H-pyrrolo[2,3-c]pyridine.
Molecular Properties
| Compound Name | 3-iodo-4-nitro-1H-pyrrolo[2,3-c]pyridine |
| PubChem CID | 53412698 |
| Molecular Formula | C7H4IN3O2 |
| Molecular Weight | 289.03 g/mol |
| Exact Mass | 288.93 |
| IUPAC Name | 3-iodo-4-nitro-1H-pyrrolo[2,3-c]pyridine |
| SMILES | O=[N+]([O-])c1cncc2[nH]cc(I)c12 |
| InChI | InChI=1S/C7H4IN3O2/c8-4-1-10-5-2-9-3-6(7(4)5)11(12)13/h1-3,10H |
| InChIKey | JMDBKPJATPNMJS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.03 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-4-nitro-1H-pyrrolo[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-4-nitro-1H-pyrrolo[2,3-c]pyridine?
The IUPAC name of 3-iodo-4-nitro-1H-pyrrolo[2,3-c]pyridine (CID 53412698) is 3-iodo-4-nitro-1H-pyrrolo[2,3-c]pyridine.
What is the SMILES notation for 3-iodo-4-nitro-1H-pyrrolo[2,3-c]pyridine?
The canonical SMILES for 3-iodo-4-nitro-1H-pyrrolo[2,3-c]pyridine is O=[N+]([O-])c1cncc2[nH]cc(I)c12.
What is the InChIKey of 3-iodo-4-nitro-1H-pyrrolo[2,3-c]pyridine?
The InChIKey is JMDBKPJATPNMJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4IN3O2/c8-4-1-10-5-2-9-3-6(7(4)5)11(12)13/h1-3,10H.
What are the key properties of 3-iodo-4-nitro-1H-pyrrolo[2,3-c]pyridine?
3-iodo-4-nitro-1H-pyrrolo[2,3-c]pyridine has a molecular weight of 289.03 g/mol, XLogP of 2.08, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-4-nitro-1H-pyrrolo[2,3-c]pyridine is sourced from PubChem (CID 53412698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).