C8H3ClFN3O6 — CID 70063138
6-chloro-7-fluoro-1,4-dihydroxy-5-nitroquinoxaline-2,3-dione (PubChem CID 70063138) has the molecular formula C8H3ClFN3O6 and a molecular weight of 291.58 g/mol. Its IUPAC name is 6-chloro-7-fluoro-1,4-dihydroxy-5-nitroquinoxaline-2,3-dione.
| Compound Name | 6-chloro-7-fluoro-1,4-dihydroxy-5-nitroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 70063138 |
| Molecular Formula | C8H3ClFN3O6 |
| Molecular Weight | 291.58 g/mol |
| Exact Mass | 290.97 |
| IUPAC Name | 6-chloro-7-fluoro-1,4-dihydroxy-5-nitroquinoxaline-2,3-dione |
| SMILES | O=c1c(=O)n(O)c2c([N+](=O)[O-])c(Cl)c(F)cc2n1O |
| InChI | InChI=1S/C8H3ClFN3O6/c9-4-2(10)1-3-5(6(4)13(18)19)12(17)8(15)7(14)11(3)16/h1,16-17H |
| InChIKey | JRLILCBLRKLGIV-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 127.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.58 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|