C6Cl2F3NO2 — CID 118841547
1,4-dichloro-2,3,5-trifluoro-6-nitrobenzene (PubChem CID 118841547) has the molecular formula C6Cl2F3NO2 and a molecular weight of 245.97 g/mol. Its IUPAC name is 1,4-dichloro-2,3,5-trifluoro-6-nitrobenzene.
| Compound Name | 1,4-dichloro-2,3,5-trifluoro-6-nitrobenzene |
|---|---|
| PubChem CID | 118841547 |
| Molecular Formula | C6Cl2F3NO2 |
| Molecular Weight | 245.97 g/mol |
| Exact Mass | 244.93 |
| IUPAC Name | 1,4-dichloro-2,3,5-trifluoro-6-nitrobenzene |
| SMILES | O=[N+]([O-])c1c(F)c(Cl)c(F)c(F)c1Cl |
| InChI | InChI=1S/C6Cl2F3NO2/c7-1-3(9)4(10)2(8)6(5(1)11)12(13)14 |
| InChIKey | CXHDKGJDTAFGEE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.97 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|