C7Cl4F3NO2 — CID 20542160
1,2,4,5-tetrachloro-3-nitro-6-(trifluoromethyl)benzene (PubChem CID 20542160) has the molecular formula C7Cl4F3NO2 and a molecular weight of 328.89 g/mol. Its IUPAC name is 1,2,4,5-tetrachloro-3-nitro-6-(trifluoromethyl)benzene.
| Compound Name | 1,2,4,5-tetrachloro-3-nitro-6-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 20542160 |
| Molecular Formula | C7Cl4F3NO2 |
| Molecular Weight | 328.89 g/mol |
| Exact Mass | 326.86 |
| IUPAC Name | 1,2,4,5-tetrachloro-3-nitro-6-(trifluoromethyl)benzene |
| SMILES | O=[N+]([O-])c1c(Cl)c(Cl)c(C(F)(F)F)c(Cl)c1Cl |
| InChI | InChI=1S/C7Cl4F3NO2/c8-2-1(7(12,13)14)3(9)5(11)6(4(2)10)15(16)17 |
| InChIKey | FXUFBKLRBKUKOG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.89 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|