C6HCl2F2NO3 — CID 14405001
2,6-dichloro-3,5-difluoro-4-nitrophenol (PubChem CID 14405001) has the molecular formula C6HCl2F2NO3 and a molecular weight of 243.98 g/mol. Its IUPAC name is 2,6-dichloro-3,5-difluoro-4-nitrophenol.
| Compound Name | 2,6-dichloro-3,5-difluoro-4-nitrophenol |
|---|---|
| PubChem CID | 14405001 |
| Molecular Formula | C6HCl2F2NO3 |
| Molecular Weight | 243.98 g/mol |
| Exact Mass | 242.93 |
| IUPAC Name | 2,6-dichloro-3,5-difluoro-4-nitrophenol |
| SMILES | O=[N+]([O-])c1c(F)c(Cl)c(O)c(Cl)c1F |
| InChI | InChI=1S/C6HCl2F2NO3/c7-1-3(9)5(11(13)14)4(10)2(8)6(1)12/h12H |
| InChIKey | FYIXXOQCUVQNFH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.98 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|