About 5-fluoro-2,4,6-trinitrobenzene-1,3-diol;hydroxylamine
5-fluoro-2,4,6-trinitrobenzene-1,3-diol;hydroxylamine (PubChem CID 175487013) has the molecular formula C6H8FN5O10
and a molecular weight of 329.15 g/mol. Its IUPAC name is 5-fluoro-2,4,6-trinitrobenzene-1,3-diol;hydroxylamine.
Molecular Properties
| Compound Name | 5-fluoro-2,4,6-trinitrobenzene-1,3-diol;hydroxylamine |
| PubChem CID | 175487013 |
| Molecular Formula | C6H8FN5O10 |
| Molecular Weight | 329.15 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 5-fluoro-2,4,6-trinitrobenzene-1,3-diol;hydroxylamine |
| SMILES | NO.NO.O=[N+]([O-])c1c(O)c([N+](=O)[O-])c(F)c([N+](=O)[O-])c1O |
| InChI | InChI=1S/C6H2FN3O8.2H3NO/c7-1-2(8(13)14)5(11)4(10(17)18)6(12)3(1)9(15)16;2*1-2/h11-12H;2*2H,1H2 |
| InChIKey | HCTPYNIRLVSMMM-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 262.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 329.15 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-2,4,6-trinitrobenzene-1,3-diol;hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2,4,6-trinitrobenzene-1,3-diol;hydroxylamine?
The IUPAC name of 5-fluoro-2,4,6-trinitrobenzene-1,3-diol;hydroxylamine (CID 175487013) is 5-fluoro-2,4,6-trinitrobenzene-1,3-diol;hydroxylamine.
What is the SMILES notation for 5-fluoro-2,4,6-trinitrobenzene-1,3-diol;hydroxylamine?
The canonical SMILES for 5-fluoro-2,4,6-trinitrobenzene-1,3-diol;hydroxylamine is NO.NO.O=[N+]([O-])c1c(O)c([N+](=O)[O-])c(F)c([N+](=O)[O-])c1O.
What is the InChIKey of 5-fluoro-2,4,6-trinitrobenzene-1,3-diol;hydroxylamine?
The InChIKey is HCTPYNIRLVSMMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2FN3O8.2H3NO/c7-1-2(8(13)14)5(11)4(10(17)18)6(12)3(1)9(15)16;2*1-2/h11-12H;2*2H,1H2.
What are the key properties of 5-fluoro-2,4,6-trinitrobenzene-1,3-diol;hydroxylamine?
5-fluoro-2,4,6-trinitrobenzene-1,3-diol;hydroxylamine has a molecular weight of 329.15 g/mol, XLogP of -0.37, 3 rotatable bonds, 6 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2,4,6-trinitrobenzene-1,3-diol;hydroxylamine is sourced from PubChem (CID 175487013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).