C12HF8N3O4 — CID 10927558
2,3,5,6-tetrafluoro-4-nitro-N-(2,3,5,6-tetrafluoro-4-nitrophenyl)aniline (PubChem CID 10927558) has the molecular formula C12HF8N3O4 and a molecular weight of 403.14 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-nitro-N-(2,3,5,6-tetrafluoro-4-nitrophenyl)aniline.
| Compound Name | 2,3,5,6-tetrafluoro-4-nitro-N-(2,3,5,6-tetrafluoro-4-nitrophenyl)aniline |
|---|---|
| PubChem CID | 10927558 |
| Molecular Formula | C12HF8N3O4 |
| Molecular Weight | 403.14 g/mol |
| Exact Mass | 402.98 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-nitro-N-(2,3,5,6-tetrafluoro-4-nitrophenyl)aniline |
| SMILES | O=[N+]([O-])c1c(F)c(F)c(Nc2c(F)c(F)c([N+](=O)[O-])c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C12HF8N3O4/c13-1-5(17)11(22(24)25)6(18)2(14)9(1)21-10-3(15)7(19)12(23(26)27)8(20)4(10)16/h21H |
| InChIKey | WOBDRGMXUVYFEN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.14 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|