C16H18F4N4O2 — CID 172869441
5,7-dimethyl-N-(2,3,5,6-tetrafluoro-4-nitrophenyl)-1,3-diazatricyclo[3.3.1.13,7]decan-6-amine (PubChem CID 172869441) has the molecular formula C16H18F4N4O2 and a molecular weight of 374.34 g/mol. Its IUPAC name is 5,7-dimethyl-N-(2,3,5,6-tetrafluoro-4-nitrophenyl)-1,3-diazatricyclo[3.3.1.13,7]decan-6-amine.
| Compound Name | 5,7-dimethyl-N-(2,3,5,6-tetrafluoro-4-nitrophenyl)-1,3-diazatricyclo[3.3.1.13,7]decan-6-amine |
|---|---|
| PubChem CID | 172869441 |
| Molecular Formula | C16H18F4N4O2 |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 5,7-dimethyl-N-(2,3,5,6-tetrafluoro-4-nitrophenyl)-1,3-diazatricyclo[3.3.1.13,7]decan-6-amine |
| SMILES | CC12CN3CN(C1)CC(C)(C3)C2Nc1c(F)c(F)c([N+](=O)[O-])c(F)c1F |
| InChI | InChI=1S/C16H18F4N4O2/c1-15-3-22-5-16(2,6-23(4-15)7-22)14(15)21-12-8(17)10(19)13(24(25)26)11(20)9(12)18/h14,21H,3-7H2,1-2H3 |
| InChIKey | GEBRSFKZKFFQLR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 61.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|