C8H2Cl2F2N2 — CID 82184445
2,3-dichloro-5,7-difluoroquinoxaline (PubChem CID 82184445) has the molecular formula C8H2Cl2F2N2 and a molecular weight of 235.02 g/mol. Its IUPAC name is 2,3-dichloro-5,7-difluoroquinoxaline.
| Compound Name | 2,3-dichloro-5,7-difluoroquinoxaline |
|---|---|
| PubChem CID | 82184445 |
| Molecular Formula | C8H2Cl2F2N2 |
| Molecular Weight | 235.02 g/mol |
| Exact Mass | 233.96 |
| IUPAC Name | 2,3-dichloro-5,7-difluoroquinoxaline |
| SMILES | Fc1cc(F)c2nc(Cl)c(Cl)nc2c1 |
| InChI | InChI=1S/C8H2Cl2F2N2/c9-7-8(10)14-6-4(12)1-3(11)2-5(6)13-7/h1-2H |
| InChIKey | UNYQOESPZMLSGX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.02 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |