C8H2Cl3FN2 — CID 154727490
2,3,5-trichloro-8-fluoroquinoxaline (PubChem CID 154727490) has the molecular formula C8H2Cl3FN2 and a molecular weight of 251.47 g/mol. Its IUPAC name is 2,3,5-trichloro-8-fluoroquinoxaline.
| Compound Name | 2,3,5-trichloro-8-fluoroquinoxaline |
|---|---|
| PubChem CID | 154727490 |
| Molecular Formula | C8H2Cl3FN2 |
| Molecular Weight | 251.47 g/mol |
| Exact Mass | 249.93 |
| IUPAC Name | 2,3,5-trichloro-8-fluoroquinoxaline |
| SMILES | Fc1ccc(Cl)c2nc(Cl)c(Cl)nc12 |
| InChI | InChI=1S/C8H2Cl3FN2/c9-3-1-2-4(12)6-5(3)13-7(10)8(11)14-6/h1-2H |
| InChIKey | IEJDXNKWOANOHK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |