C10H4Cl2F3N — CID 107530946
4,8-dichloro-2-(difluoromethyl)-5-fluoroquinoline (PubChem CID 107530946) has the molecular formula C10H4Cl2F3N and a molecular weight of 266.05 g/mol. Its IUPAC name is 4,8-dichloro-2-(difluoromethyl)-5-fluoroquinoline.
| Compound Name | 4,8-dichloro-2-(difluoromethyl)-5-fluoroquinoline |
|---|---|
| PubChem CID | 107530946 |
| Molecular Formula | C10H4Cl2F3N |
| Molecular Weight | 266.05 g/mol |
| Exact Mass | 264.97 |
| IUPAC Name | 4,8-dichloro-2-(difluoromethyl)-5-fluoroquinoline |
| SMILES | Fc1ccc(Cl)c2nc(C(F)F)cc(Cl)c12 |
| InChI | InChI=1S/C10H4Cl2F3N/c11-4-1-2-6(13)8-5(12)3-7(10(14)15)16-9(4)8/h1-3,10H |
| InChIKey | CRSQHAYNBPIHHS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.05 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |