C6H2Cl2F2IN — CID 119020457
2,4-dichloro-6-(difluoromethyl)-3-iodopyridine (PubChem CID 119020457) has the molecular formula C6H2Cl2F2IN and a molecular weight of 323.90 g/mol. Its IUPAC name is 2,4-dichloro-6-(difluoromethyl)-3-iodopyridine.
| Compound Name | 2,4-dichloro-6-(difluoromethyl)-3-iodopyridine |
|---|---|
| PubChem CID | 119020457 |
| Molecular Formula | C6H2Cl2F2IN |
| Molecular Weight | 323.90 g/mol |
| Exact Mass | 322.86 |
| IUPAC Name | 2,4-dichloro-6-(difluoromethyl)-3-iodopyridine |
| SMILES | FC(F)c1cc(Cl)c(I)c(Cl)n1 |
| InChI | InChI=1S/C6H2Cl2F2IN/c7-2-1-3(6(9)10)12-5(8)4(2)11/h1,6H |
| InChIKey | IYVOCBHQVMCHAJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.90 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|