C8H6I3NO2 — CID 139820318
1,2,3-triiodo-4,6-dimethyl-5-nitrobenzene (PubChem CID 139820318) has the molecular formula C8H6I3NO2 and a molecular weight of 528.85 g/mol. Its IUPAC name is 1,2,3-triiodo-4,6-dimethyl-5-nitrobenzene.
| Compound Name | 1,2,3-triiodo-4,6-dimethyl-5-nitrobenzene |
|---|---|
| PubChem CID | 139820318 |
| Molecular Formula | C8H6I3NO2 |
| Molecular Weight | 528.85 g/mol |
| Exact Mass | 528.75 |
| IUPAC Name | 1,2,3-triiodo-4,6-dimethyl-5-nitrobenzene |
| SMILES | Cc1c(I)c(I)c(I)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H6I3NO2/c1-3-5(9)7(11)6(10)4(2)8(3)12(13)14/h1-2H3 |
| InChIKey | FUKKWKAOXYPWJI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.85 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|