C11H14ClNO2 — CID 15211999
1-(chloromethyl)-2,3,4,6-tetramethyl-5-nitrobenzene (PubChem CID 15211999) has the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. Its IUPAC name is 1-(chloromethyl)-2,3,4,6-tetramethyl-5-nitrobenzene.
| Compound Name | 1-(chloromethyl)-2,3,4,6-tetramethyl-5-nitrobenzene |
|---|---|
| PubChem CID | 15211999 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 1-(chloromethyl)-2,3,4,6-tetramethyl-5-nitrobenzene |
| SMILES | Cc1c(C)c(CCl)c(C)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C11H14ClNO2/c1-6-7(2)10(5-12)9(4)11(8(6)3)13(14)15/h5H2,1-4H3 |
| InChIKey | UBYQJVNVUZYYKV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|