C16H23NO4 — CID 121354462
tert-butyl 2-(2,3,4,5-tetramethyl-6-nitrophenyl)acetate (PubChem CID 121354462) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is tert-butyl 2-(2,3,4,5-tetramethyl-6-nitrophenyl)acetate.
| Compound Name | tert-butyl 2-(2,3,4,5-tetramethyl-6-nitrophenyl)acetate |
|---|---|
| PubChem CID | 121354462 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | tert-butyl 2-(2,3,4,5-tetramethyl-6-nitrophenyl)acetate |
| SMILES | Cc1c(C)c(C)c([N+](=O)[O-])c(CC(=O)OC(C)(C)C)c1C |
| InChI | InChI=1S/C16H23NO4/c1-9-10(2)12(4)15(17(19)20)13(11(9)3)8-14(18)21-16(5,6)7/h8H2,1-7H3 |
| InChIKey | HDNLZJFJQHEKPM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|