C22H22N2O11 — CID 4042514
dimethyl 2-[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,6-dinitrophenoxy]benzene-1,3-dicarboxylate (PubChem CID 4042514) has the molecular formula C22H22N2O11 and a molecular weight of 490.42 g/mol. Its IUPAC name is dimethyl 2-[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,6-dinitrophenoxy]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 2-[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,6-dinitrophenoxy]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 4042514 |
| Molecular Formula | C22H22N2O11 |
| Molecular Weight | 490.42 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | dimethyl 2-[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,6-dinitrophenoxy]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cccc(C(=O)OC)c1Oc1c([N+](=O)[O-])ccc(CC(=O)OC(C)(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H22N2O11/c1-22(2,3)35-16(25)11-12-9-10-15(23(28)29)19(17(12)24(30)31)34-18-13(20(26)32-4)7-6-8-14(18)21(27)33-5/h6-10H,11H2,1-5H3 |
| InChIKey | NIAMSJHHNJJSOL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 174.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|