C12H14F5NO4S — CID 53342667
tert-butyl 2-[2-nitro-5-(pentafluoro-λ6-sulfanyl)phenyl]acetate (PubChem CID 53342667) has the molecular formula C12H14F5NO4S and a molecular weight of 363.30 g/mol. Its IUPAC name is tert-butyl 2-[2-nitro-5-(pentafluoro-λ6-sulfanyl)phenyl]acetate.
| Compound Name | tert-butyl 2-[2-nitro-5-(pentafluoro-λ6-sulfanyl)phenyl]acetate |
|---|---|
| PubChem CID | 53342667 |
| Molecular Formula | C12H14F5NO4S |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | tert-butyl 2-[2-nitro-5-(pentafluoro-λ6-sulfanyl)phenyl]acetate |
| SMILES | CC(C)(C)OC(=O)Cc1cc(S(F)(F)(F)(F)F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14F5NO4S/c1-12(2,3)22-11(19)7-8-6-9(23(13,14,15,16)17)4-5-10(8)18(20)21/h4-6H,7H2,1-3H3 |
| InChIKey | UNKGTVBWNZETOO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|