C26H32N4O12 — CID 160943695
methyl 2-amino-3-nitrobenzoate;methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-nitrobenzoate (PubChem CID 160943695) has the molecular formula C26H32N4O12 and a molecular weight of 592.56 g/mol. Its IUPAC name is methyl 2-amino-3-nitrobenzoate;methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-nitrobenzoate.
| Compound Name | methyl 2-amino-3-nitrobenzoate;methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-nitrobenzoate |
|---|---|
| PubChem CID | 160943695 |
| Molecular Formula | C26H32N4O12 |
| Molecular Weight | 592.56 g/mol |
| Exact Mass | 592.20 |
| IUPAC Name | methyl 2-amino-3-nitrobenzoate;methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-nitrobenzoate |
| SMILES | COC(=O)c1cccc([N+](=O)[O-])c1N.COC(=O)c1cccc([N+](=O)[O-])c1N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H24N2O8.C8H8N2O4/c1-17(2,3)27-15(22)19(16(23)28-18(4,5)6)13-11(14(21)26-7)9-8-10-12(13)20(24)25;1-14-8(11)5-3-2-4-6(7(5)9)10(12)13/h8-10H,1-7H3;2-4H,9H2,1H3 |
| InChIKey | SUVJWYCHZCEFDJ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 220.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.56 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|