C20H32N2O6 — CID 145443952
tert-butyl N-(2,4-dimethyl-6-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;ethane (PubChem CID 145443952) has the molecular formula C20H32N2O6 and a molecular weight of 396.48 g/mol. Its IUPAC name is tert-butyl N-(2,4-dimethyl-6-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;ethane.
| Compound Name | tert-butyl N-(2,4-dimethyl-6-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;ethane |
|---|---|
| PubChem CID | 145443952 |
| Molecular Formula | C20H32N2O6 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | tert-butyl N-(2,4-dimethyl-6-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;ethane |
| SMILES | CC.Cc1cc(C)c(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H26N2O6.C2H6/c1-11-9-12(2)14(13(10-11)20(23)24)19(15(21)25-17(3,4)5)16(22)26-18(6,7)8;1-2/h9-10H,1-8H3;1-2H3 |
| InChIKey | RWMODZBLLLJRTC-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|