About tert-butyl N-(2,4-dimethyl-6-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;ethane
tert-butyl N-(2,4-dimethyl-6-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;ethane (PubChem CID 145443952) has the molecular formula C20H32N2O6
and a molecular weight of 396.48 g/mol. Its IUPAC name is tert-butyl N-(2,4-dimethyl-6-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;ethane.
Molecular Properties
| Compound Name | tert-butyl N-(2,4-dimethyl-6-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;ethane |
| PubChem CID | 145443952 |
| Molecular Formula | C20H32N2O6 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | tert-butyl N-(2,4-dimethyl-6-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;ethane |
| SMILES | CC.Cc1cc(C)c(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H26N2O6.C2H6/c1-11-9-12(2)14(13(10-11)20(23)24)19(15(21)25-17(3,4)5)16(22)26-18(6,7)8;1-2/h9-10H,1-8H3;1-2H3 |
| InChIKey | RWMODZBLLLJRTC-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-(2,4-dimethyl-6-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(2,4-dimethyl-6-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;ethane?
The IUPAC name of tert-butyl N-(2,4-dimethyl-6-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;ethane (CID 145443952) is tert-butyl N-(2,4-dimethyl-6-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;ethane.
What is the SMILES notation for tert-butyl N-(2,4-dimethyl-6-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;ethane?
The canonical SMILES for tert-butyl N-(2,4-dimethyl-6-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;ethane is CC.Cc1cc(C)c(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c([N+](=O)[O-])c1.
What is the InChIKey of tert-butyl N-(2,4-dimethyl-6-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;ethane?
The InChIKey is RWMODZBLLLJRTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O6.C2H6/c1-11-9-12(2)14(13(10-11)20(23)24)19(15(21)25-17(3,4)5)16(22)26-18(6,7)8;1-2/h9-10H,1-8H3;1-2H3.
What are the key properties of tert-butyl N-(2,4-dimethyl-6-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;ethane?
tert-butyl N-(2,4-dimethyl-6-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;ethane has a molecular weight of 396.48 g/mol, XLogP of 5.91, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(2,4-dimethyl-6-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;ethane is sourced from PubChem (CID 145443952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).