C13H14BrClN2O6 — CID 139533317
2-[4-bromo-2-chloro-N-[(2-methylpropan-2-yl)oxycarbonyl]-6-nitroanilino]acetic acid (PubChem CID 139533317) has the molecular formula C13H14BrClN2O6 and a molecular weight of 409.62 g/mol. Its IUPAC name is 2-[4-bromo-2-chloro-N-[(2-methylpropan-2-yl)oxycarbonyl]-6-nitroanilino]acetic acid.
| Compound Name | 2-[4-bromo-2-chloro-N-[(2-methylpropan-2-yl)oxycarbonyl]-6-nitroanilino]acetic acid |
|---|---|
| PubChem CID | 139533317 |
| Molecular Formula | C13H14BrClN2O6 |
| Molecular Weight | 409.62 g/mol |
| Exact Mass | 407.97 |
| IUPAC Name | 2-[4-bromo-2-chloro-N-[(2-methylpropan-2-yl)oxycarbonyl]-6-nitroanilino]acetic acid |
| SMILES | CC(C)(C)OC(=O)N(CC(=O)O)c1c(Cl)cc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14BrClN2O6/c1-13(2,3)23-12(20)16(6-10(18)19)11-8(15)4-7(14)5-9(11)17(21)22/h4-5H,6H2,1-3H3,(H,18,19) |
| InChIKey | KECLHJXPWMWXKR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.62 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|